C17H25Br — CID 55223661
5-bromo-3-butyl-7,7-dimethyl-5,6,8,9-tetrahydrobenzo[7]annulene (PubChem CID 55223661) has the molecular formula C17H25Br and a molecular weight of 309.29 g/mol. Its IUPAC name is 5-bromo-3-butyl-7,7-dimethyl-5,6,8,9-tetrahydrobenzo[7]annulene.
| Compound Name | 5-bromo-3-butyl-7,7-dimethyl-5,6,8,9-tetrahydrobenzo[7]annulene |
|---|---|
| PubChem CID | 55223661 |
| Molecular Formula | C17H25Br |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 5-bromo-3-butyl-7,7-dimethyl-5,6,8,9-tetrahydrobenzo[7]annulene |
| SMILES | CCCCc1ccc2c(c1)C(Br)CC(C)(C)CC2 |
| InChI | InChI=1S/C17H25Br/c1-4-5-6-13-7-8-14-9-10-17(2,3)12-16(18)15(14)11-13/h7-8,11,16H,4-6,9-10,12H2,1-3H3 |
| InChIKey | QMTPTLFSWIBNCT-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|