C14H19N — CID 115483155
(1R)-3,3-dimethyl-2,5,6,7-tetrahydro-1H-s-indacen-1-amine (PubChem CID 115483155) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is (1R)-3,3-dimethyl-2,5,6,7-tetrahydro-1H-s-indacen-1-amine.
| Compound Name | (1R)-3,3-dimethyl-2,5,6,7-tetrahydro-1H-s-indacen-1-amine |
|---|---|
| PubChem CID | 115483155 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (1R)-3,3-dimethyl-2,5,6,7-tetrahydro-1H-s-indacen-1-amine |
| SMILES | CC1(C)C[C@@H](N)c2cc3c(cc21)CCC3 |
| InChI | InChI=1S/C14H19N/c1-14(2)8-13(15)11-6-9-4-3-5-10(9)7-12(11)14/h6-7,13H,3-5,8,15H2,1-2H3/t13-/m1/s1 |
| InChIKey | GBCYRKWIONZZPU-CYBMUJFWSA-N |
| XLogP | 2.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |