C15H21N — CID 115483154
N,3,3-trimethyl-2,5,6,7-tetrahydro-1H-s-indacen-1-amine (PubChem CID 115483154) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is N,3,3-trimethyl-2,5,6,7-tetrahydro-1H-s-indacen-1-amine.
| Compound Name | N,3,3-trimethyl-2,5,6,7-tetrahydro-1H-s-indacen-1-amine |
|---|---|
| PubChem CID | 115483154 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | N,3,3-trimethyl-2,5,6,7-tetrahydro-1H-s-indacen-1-amine |
| SMILES | CNC1CC(C)(C)c2cc3c(cc21)CCC3 |
| InChI | InChI=1S/C15H21N/c1-15(2)9-14(16-3)12-7-10-5-4-6-11(10)8-13(12)15/h7-8,14,16H,4-6,9H2,1-3H3 |
| InChIKey | RFMDELZEXVGJSF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |