C16H23NO — CID 64696866
N,2,2-trimethyl-3,4,6,7,8,9-hexahydrobenzo[g]chromen-4-amine (PubChem CID 64696866) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is N,2,2-trimethyl-3,4,6,7,8,9-hexahydrobenzo[g]chromen-4-amine.
| Compound Name | N,2,2-trimethyl-3,4,6,7,8,9-hexahydrobenzo[g]chromen-4-amine |
|---|---|
| PubChem CID | 64696866 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | N,2,2-trimethyl-3,4,6,7,8,9-hexahydrobenzo[g]chromen-4-amine |
| SMILES | CNC1CC(C)(C)Oc2cc3c(cc21)CCCC3 |
| InChI | InChI=1S/C16H23NO/c1-16(2)10-14(17-3)13-8-11-6-4-5-7-12(11)9-15(13)18-16/h8-9,14,17H,4-7,10H2,1-3H3 |
| InChIKey | HQAGFVQYYDKWPU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |