C25H31NO3 — CID 100761977
(2S)-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)-N-[(4R)-2,2,6-trimethyl-3,4-dihydrochromen-4-yl]propanamide (PubChem CID 100761977) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is (2S)-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)-N-[(4R)-2,2,6-trimethyl-3,4-dihydrochromen-4-yl]propanamide.
| Compound Name | (2S)-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)-N-[(4R)-2,2,6-trimethyl-3,4-dihydrochromen-4-yl]propanamide |
|---|---|
| PubChem CID | 100761977 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | (2S)-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)-N-[(4R)-2,2,6-trimethyl-3,4-dihydrochromen-4-yl]propanamide |
| SMILES | Cc1ccc2c(c1)[C@H](NC(=O)[C@H](C)Oc1ccc3c(c1)CCCC3)CC(C)(C)O2 |
| InChI | InChI=1S/C25H31NO3/c1-16-9-12-23-21(13-16)22(15-25(3,4)29-23)26-24(27)17(2)28-20-11-10-18-7-5-6-8-19(18)14-20/h9-14,17,22H,5-8,15H2,1-4H3,(H,26,27)/t17-,22+/m0/s1 |
| InChIKey | LSSITXHQQSFTLI-HTAPYJJXSA-N |
| XLogP | 5.06 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |