C26H33NO3 — CID 133184646
2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)-N-(2,2,7-trimethyl-3,4-dihydrochromen-4-yl)butanamide (PubChem CID 133184646) has the molecular formula C26H33NO3 and a molecular weight of 407.55 g/mol. Its IUPAC name is 2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)-N-(2,2,7-trimethyl-3,4-dihydrochromen-4-yl)butanamide.
| Compound Name | 2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)-N-(2,2,7-trimethyl-3,4-dihydrochromen-4-yl)butanamide |
|---|---|
| PubChem CID | 133184646 |
| Molecular Formula | C26H33NO3 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | 2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)-N-(2,2,7-trimethyl-3,4-dihydrochromen-4-yl)butanamide |
| SMILES | CCC(Oc1ccc2c(c1)CCCC2)C(=O)NC1CC(C)(C)Oc2cc(C)ccc21 |
| InChI | InChI=1S/C26H33NO3/c1-5-23(29-20-12-11-18-8-6-7-9-19(18)15-20)25(28)27-22-16-26(3,4)30-24-14-17(2)10-13-21(22)24/h10-15,22-23H,5-9,16H2,1-4H3,(H,27,28) |
| InChIKey | IDMPIKARQOZASC-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |