C21H24ClNO3 — CID 132656164
2-(3-chlorophenoxy)-N-(2,2-dimethyl-3,4-dihydrochromen-4-yl)butanamide (PubChem CID 132656164) has the molecular formula C21H24ClNO3 and a molecular weight of 373.88 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-N-(2,2-dimethyl-3,4-dihydrochromen-4-yl)butanamide.
| Compound Name | 2-(3-chlorophenoxy)-N-(2,2-dimethyl-3,4-dihydrochromen-4-yl)butanamide |
|---|---|
| PubChem CID | 132656164 |
| Molecular Formula | C21H24ClNO3 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 2-(3-chlorophenoxy)-N-(2,2-dimethyl-3,4-dihydrochromen-4-yl)butanamide |
| SMILES | CCC(Oc1cccc(Cl)c1)C(=O)NC1CC(C)(C)Oc2ccccc21 |
| InChI | InChI=1S/C21H24ClNO3/c1-4-18(25-15-9-7-8-14(22)12-15)20(24)23-17-13-21(2,3)26-19-11-6-5-10-16(17)19/h5-12,17-18H,4,13H2,1-3H3,(H,23,24) |
| InChIKey | MWUNGIBOJFYVHL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |