C15H20O — CID 115483220
(1S)-3,3-dimethyl-1,2,5,6,7,8-hexahydrocyclopenta[b]naphthalen-1-ol (PubChem CID 115483220) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is (1S)-3,3-dimethyl-1,2,5,6,7,8-hexahydrocyclopenta[b]naphthalen-1-ol.
| Compound Name | (1S)-3,3-dimethyl-1,2,5,6,7,8-hexahydrocyclopenta[b]naphthalen-1-ol |
|---|---|
| PubChem CID | 115483220 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (1S)-3,3-dimethyl-1,2,5,6,7,8-hexahydrocyclopenta[b]naphthalen-1-ol |
| SMILES | CC1(C)C[C@H](O)c2cc3c(cc21)CCCC3 |
| InChI | InChI=1S/C15H20O/c1-15(2)9-14(16)12-7-10-5-3-4-6-11(10)8-13(12)15/h7-8,14,16H,3-6,9H2,1-2H3/t14-/m0/s1 |
| InChIKey | JHPCPJYKPXAKPU-AWEZNQCLSA-N |
| XLogP | 3.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |