C16H22O — CID 113319284
7,7-dimethyl-2,3,5,6,8,9-hexahydro-1H-cyclohepta[f]inden-5-ol (PubChem CID 113319284) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is 7,7-dimethyl-2,3,5,6,8,9-hexahydro-1H-cyclohepta[f]inden-5-ol.
| Compound Name | 7,7-dimethyl-2,3,5,6,8,9-hexahydro-1H-cyclohepta[f]inden-5-ol |
|---|---|
| PubChem CID | 113319284 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 7,7-dimethyl-2,3,5,6,8,9-hexahydro-1H-cyclohepta[f]inden-5-ol |
| SMILES | CC1(C)CCc2cc3c(cc2C(O)C1)CCC3 |
| InChI | InChI=1S/C16H22O/c1-16(2)7-6-13-8-11-4-3-5-12(11)9-14(13)15(17)10-16/h8-9,15,17H,3-7,10H2,1-2H3 |
| InChIKey | YPTAYWXAVQFYDZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |