C17H24 — CID 139783545
1,1,3,3-tetramethyl-5,6,7,8-tetrahydro-2H-cyclopenta[b]naphthalene (PubChem CID 139783545) has the molecular formula C17H24 and a molecular weight of 228.38 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-5,6,7,8-tetrahydro-2H-cyclopenta[b]naphthalene.
| Compound Name | 1,1,3,3-tetramethyl-5,6,7,8-tetrahydro-2H-cyclopenta[b]naphthalene |
|---|---|
| PubChem CID | 139783545 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 1,1,3,3-tetramethyl-5,6,7,8-tetrahydro-2H-cyclopenta[b]naphthalene |
| SMILES | CC1(C)CC(C)(C)c2cc3c(cc21)CCCC3 |
| InChI | InChI=1S/C17H24/c1-16(2)11-17(3,4)15-10-13-8-6-5-7-12(13)9-14(15)16/h9-10H,5-8,11H2,1-4H3 |
| InChIKey | HBIAXWVLEMLMRN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |