C15H23N — CID 115483206
(1R)-5,6-diethyl-3,3-dimethyl-1,2-dihydroinden-1-amine (PubChem CID 115483206) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is (1R)-5,6-diethyl-3,3-dimethyl-1,2-dihydroinden-1-amine.
| Compound Name | (1R)-5,6-diethyl-3,3-dimethyl-1,2-dihydroinden-1-amine |
|---|---|
| PubChem CID | 115483206 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | (1R)-5,6-diethyl-3,3-dimethyl-1,2-dihydroinden-1-amine |
| SMILES | CCc1cc2c(cc1CC)C(C)(C)C[C@H]2N |
| InChI | InChI=1S/C15H23N/c1-5-10-7-12-13(8-11(10)6-2)15(3,4)9-14(12)16/h7-8,14H,5-6,9,16H2,1-4H3/t14-/m1/s1 |
| InChIKey | KVJBHFQTZFCSTM-CQSZACIVSA-N |
| XLogP | 3.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |