C12H14BrNO — CID 84640610
2-amino-7-bromo-4,4-dimethyl-2,3-dihydronaphthalen-1-one (PubChem CID 84640610) has the molecular formula C12H14BrNO and a molecular weight of 268.15 g/mol. Its IUPAC name is 2-amino-7-bromo-4,4-dimethyl-2,3-dihydronaphthalen-1-one.
| Compound Name | 2-amino-7-bromo-4,4-dimethyl-2,3-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 84640610 |
| Molecular Formula | C12H14BrNO |
| Molecular Weight | 268.15 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 2-amino-7-bromo-4,4-dimethyl-2,3-dihydronaphthalen-1-one |
| SMILES | CC1(C)CC(N)C(=O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C12H14BrNO/c1-12(2)6-10(14)11(15)8-5-7(13)3-4-9(8)12/h3-5,10H,6,14H2,1-2H3 |
| InChIKey | IPDFAJYIWMUNBM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.15 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |