C12H16BrNO2 — CID 116995533
1-bromo-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinoline (PubChem CID 116995533) has the molecular formula C12H16BrNO2 and a molecular weight of 286.17 g/mol. Its IUPAC name is 1-bromo-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 1-bromo-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 116995533 |
| Molecular Formula | C12H16BrNO2 |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 1-bromo-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1cc2c(cc1OC)C(Br)N(C)CC2 |
| InChI | InChI=1S/C12H16BrNO2/c1-14-5-4-8-6-10(15-2)11(16-3)7-9(8)12(14)13/h6-7,12H,4-5H2,1-3H3 |
| InChIKey | KJEPEGUTJGNNFF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|