C18H20BrNO3 — CID 609741
4-bromo-2-(6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl)phenol (PubChem CID 609741) has the molecular formula C18H20BrNO3 and a molecular weight of 378.27 g/mol. Its IUPAC name is 4-bromo-2-(6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl)phenol.
| Compound Name | 4-bromo-2-(6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl)phenol |
|---|---|
| PubChem CID | 609741 |
| Molecular Formula | C18H20BrNO3 |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 4-bromo-2-(6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl)phenol |
| SMILES | COc1cc2c(cc1OC)C(c1cc(Br)ccc1O)N(C)CC2 |
| InChI | InChI=1S/C18H20BrNO3/c1-20-7-6-11-8-16(22-2)17(23-3)10-13(11)18(20)14-9-12(19)4-5-15(14)21/h4-5,8-10,18,21H,6-7H2,1-3H3 |
| InChIKey | JEOKXNLJLFGKND-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|