C14H11BrO4 — CID 135018935
2-bromo-5-(2,6-dimethoxyphenyl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 135018935) has the molecular formula C14H11BrO4 and a molecular weight of 323.14 g/mol. Its IUPAC name is 2-bromo-5-(2,6-dimethoxyphenyl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-bromo-5-(2,6-dimethoxyphenyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 135018935 |
| Molecular Formula | C14H11BrO4 |
| Molecular Weight | 323.14 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | 2-bromo-5-(2,6-dimethoxyphenyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | COc1cccc(OC)c1C1=CC(=O)C(Br)=CC1=O |
| InChI | InChI=1S/C14H11BrO4/c1-18-12-4-3-5-13(19-2)14(12)8-6-11(17)9(15)7-10(8)16/h3-7H,1-2H3 |
| InChIKey | SRJWCFHDLIIVGH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.14 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|