About 2-hexylsulfinyl-5,8-dimethoxynaphthalene-1,4-dione
2-hexylsulfinyl-5,8-dimethoxynaphthalene-1,4-dione (PubChem CID 69187139) has the molecular formula C18H22O5S
and a molecular weight of 350.44 g/mol. Its IUPAC name is 2-hexylsulfinyl-5,8-dimethoxynaphthalene-1,4-dione.
Molecular Properties
| Compound Name | 2-hexylsulfinyl-5,8-dimethoxynaphthalene-1,4-dione |
| PubChem CID | 69187139 |
| Molecular Formula | C18H22O5S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 2-hexylsulfinyl-5,8-dimethoxynaphthalene-1,4-dione |
| SMILES | CCCCCCS(=O)C1=CC(=O)c2c(OC)ccc(OC)c2C1=O |
| InChI | InChI=1S/C18H22O5S/c1-4-5-6-7-10-24(21)15-11-12(19)16-13(22-2)8-9-14(23-3)17(16)18(15)20/h8-9,11H,4-7,10H2,1-3H3 |
| InChIKey | SCGDDNNBHPWGBT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hexylsulfinyl-5,8-dimethoxynaphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexylsulfinyl-5,8-dimethoxynaphthalene-1,4-dione?
The IUPAC name of 2-hexylsulfinyl-5,8-dimethoxynaphthalene-1,4-dione (CID 69187139) is 2-hexylsulfinyl-5,8-dimethoxynaphthalene-1,4-dione.
What is the SMILES notation for 2-hexylsulfinyl-5,8-dimethoxynaphthalene-1,4-dione?
The canonical SMILES for 2-hexylsulfinyl-5,8-dimethoxynaphthalene-1,4-dione is CCCCCCS(=O)C1=CC(=O)c2c(OC)ccc(OC)c2C1=O.
What is the InChIKey of 2-hexylsulfinyl-5,8-dimethoxynaphthalene-1,4-dione?
The InChIKey is SCGDDNNBHPWGBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O5S/c1-4-5-6-7-10-24(21)15-11-12(19)16-13(22-2)8-9-14(23-3)17(16)18(15)20/h8-9,11H,4-7,10H2,1-3H3.
What are the key properties of 2-hexylsulfinyl-5,8-dimethoxynaphthalene-1,4-dione?
2-hexylsulfinyl-5,8-dimethoxynaphthalene-1,4-dione has a molecular weight of 350.44 g/mol, XLogP of 3.30, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexylsulfinyl-5,8-dimethoxynaphthalene-1,4-dione is sourced from PubChem (CID 69187139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).