C18H22O5S — CID 69187139
2-hexylsulfinyl-5,8-dimethoxynaphthalene-1,4-dione (PubChem CID 69187139) has the molecular formula C18H22O5S and a molecular weight of 350.44 g/mol. Its IUPAC name is 2-hexylsulfinyl-5,8-dimethoxynaphthalene-1,4-dione.
| Compound Name | 2-hexylsulfinyl-5,8-dimethoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 69187139 |
| Molecular Formula | C18H22O5S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 2-hexylsulfinyl-5,8-dimethoxynaphthalene-1,4-dione |
| SMILES | CCCCCCS(=O)C1=CC(=O)c2c(OC)ccc(OC)c2C1=O |
| InChI | InChI=1S/C18H22O5S/c1-4-5-6-7-10-24(21)15-11-12(19)16-13(22-2)8-9-14(23-3)17(16)18(15)20/h8-9,11H,4-7,10H2,1-3H3 |
| InChIKey | SCGDDNNBHPWGBT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|