C16H19NO5 — CID 72547559
2-(1-hydroxybutan-2-ylamino)-5,8-dimethoxynaphthalene-1,4-dione (PubChem CID 72547559) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is 2-(1-hydroxybutan-2-ylamino)-5,8-dimethoxynaphthalene-1,4-dione.
| Compound Name | 2-(1-hydroxybutan-2-ylamino)-5,8-dimethoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 72547559 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 2-(1-hydroxybutan-2-ylamino)-5,8-dimethoxynaphthalene-1,4-dione |
| SMILES | CCC(CO)NC1=CC(=O)c2c(OC)ccc(OC)c2C1=O |
| InChI | InChI=1S/C16H19NO5/c1-4-9(8-18)17-10-7-11(19)14-12(21-2)5-6-13(22-3)15(14)16(10)20/h5-7,9,17-18H,4,8H2,1-3H3 |
| InChIKey | HKVAEKDFGSSREB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|