C15H18N2O4 — CID 142711879
5,8-dimethoxy-2-[2-(methylamino)ethylamino]naphthalene-1,4-dione (PubChem CID 142711879) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 5,8-dimethoxy-2-[2-(methylamino)ethylamino]naphthalene-1,4-dione.
| Compound Name | 5,8-dimethoxy-2-[2-(methylamino)ethylamino]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 142711879 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 5,8-dimethoxy-2-[2-(methylamino)ethylamino]naphthalene-1,4-dione |
| SMILES | CNCCNC1=CC(=O)c2c(OC)ccc(OC)c2C1=O |
| InChI | InChI=1S/C15H18N2O4/c1-16-6-7-17-9-8-10(18)13-11(20-2)4-5-12(21-3)14(13)15(9)19/h4-5,8,16-17H,6-7H2,1-3H3 |
| InChIKey | NOWPGQJZLFTNAF-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|