C19H22O5 — CID 10496652
2-heptanoyl-5,8-dimethoxynaphthalene-1,4-dione (PubChem CID 10496652) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is 2-heptanoyl-5,8-dimethoxynaphthalene-1,4-dione.
| Compound Name | 2-heptanoyl-5,8-dimethoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 10496652 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 2-heptanoyl-5,8-dimethoxynaphthalene-1,4-dione |
| SMILES | CCCCCCC(=O)C1=CC(=O)c2c(OC)ccc(OC)c2C1=O |
| InChI | InChI=1S/C19H22O5/c1-4-5-6-7-8-13(20)12-11-14(21)17-15(23-2)9-10-16(24-3)18(17)19(12)22/h9-11H,4-8H2,1-3H3 |
| InChIKey | WLQLGVHMLAVQPR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|