C18H23NO4 — CID 123531449
2-hexylimino-5,8-dimethoxynaphthalene-1,4-dione (PubChem CID 123531449) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is 2-hexylimino-5,8-dimethoxynaphthalene-1,4-dione.
| Compound Name | 2-hexylimino-5,8-dimethoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 123531449 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 2-hexylimino-5,8-dimethoxynaphthalene-1,4-dione |
| SMILES | CCCCCC/N=C1\CC(=O)c2c(OC)ccc(OC)c2C1=O |
| InChI | InChI=1S/C18H23NO4/c1-4-5-6-7-10-19-12-11-13(20)16-14(22-2)8-9-15(23-3)17(16)18(12)21/h8-9H,4-7,10-11H2,1-3H3/b19-12+ |
| InChIKey | PDZGDDUEVRGDSD-XDHOZWIPSA-N |
| XLogP | 3.49 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|