C15H14O6 — CID 102153258
ethyl 5,7-dimethoxy-1,4-dioxonaphthalene-2-carboxylate (PubChem CID 102153258) has the molecular formula C15H14O6 and a molecular weight of 290.27 g/mol. Its IUPAC name is ethyl 5,7-dimethoxy-1,4-dioxonaphthalene-2-carboxylate.
| Compound Name | ethyl 5,7-dimethoxy-1,4-dioxonaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 102153258 |
| Molecular Formula | C15H14O6 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | ethyl 5,7-dimethoxy-1,4-dioxonaphthalene-2-carboxylate |
| SMILES | CCOC(=O)C1=CC(=O)c2c(OC)cc(OC)cc2C1=O |
| InChI | InChI=1S/C15H14O6/c1-4-21-15(18)10-7-11(16)13-9(14(10)17)5-8(19-2)6-12(13)20-3/h5-7H,4H2,1-3H3 |
| InChIKey | JSMXLDDTXIIWRL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|