C19H15ClO8 — CID 163046834
methyl 8-chloro-10-formyl-2,9-dihydroxy-1,4,7-trimethyl-6-oxobenzo[b][1,4]benzodioxepine-3-carboxylate (PubChem CID 163046834) has the molecular formula C19H15ClO8 and a molecular weight of 406.77 g/mol. Its IUPAC name is methyl 8-chloro-10-formyl-2,9-dihydroxy-1,4,7-trimethyl-6-oxobenzo[b][1,4]benzodioxepine-3-carboxylate.
| Compound Name | methyl 8-chloro-10-formyl-2,9-dihydroxy-1,4,7-trimethyl-6-oxobenzo[b][1,4]benzodioxepine-3-carboxylate |
|---|---|
| PubChem CID | 163046834 |
| Molecular Formula | C19H15ClO8 |
| Molecular Weight | 406.77 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | methyl 8-chloro-10-formyl-2,9-dihydroxy-1,4,7-trimethyl-6-oxobenzo[b][1,4]benzodioxepine-3-carboxylate |
| SMILES | COC(=O)c1c(C)c2c(c(C)c1O)Oc1c(C=O)c(O)c(Cl)c(C)c1C(=O)O2 |
| InChI | InChI=1S/C19H15ClO8/c1-6-11-17(9(5-21)14(23)12(6)20)27-16-8(3)13(22)10(18(24)26-4)7(2)15(16)28-19(11)25/h5,22-23H,1-4H3 |
| InChIKey | ROQSFVIIHOMWHH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.77 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|