C20H18O9 — CID 14727691
ethyl 10-formyl-3,9-dihydroxy-4-(hydroxymethyl)-1,7-dimethyl-6-oxobenzo[b][1,4]benzodioxepine-2-carboxylate (PubChem CID 14727691) has the molecular formula C20H18O9 and a molecular weight of 402.36 g/mol. Its IUPAC name is ethyl 10-formyl-3,9-dihydroxy-4-(hydroxymethyl)-1,7-dimethyl-6-oxobenzo[b][1,4]benzodioxepine-2-carboxylate.
| Compound Name | ethyl 10-formyl-3,9-dihydroxy-4-(hydroxymethyl)-1,7-dimethyl-6-oxobenzo[b][1,4]benzodioxepine-2-carboxylate |
|---|---|
| PubChem CID | 14727691 |
| Molecular Formula | C20H18O9 |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | ethyl 10-formyl-3,9-dihydroxy-4-(hydroxymethyl)-1,7-dimethyl-6-oxobenzo[b][1,4]benzodioxepine-2-carboxylate |
| SMILES | CCOC(=O)c1c(C)c2c(c(CO)c1O)OC(=O)c1c(C)cc(O)c(C=O)c1O2 |
| InChI | InChI=1S/C20H18O9/c1-4-27-19(25)14-9(3)16-18(11(7-22)15(14)24)29-20(26)13-8(2)5-12(23)10(6-21)17(13)28-16/h5-6,22-24H,4,7H2,1-3H3 |
| InChIKey | LGLVGQMHNYZNRY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|