C30H38O9 — CID 142792751
4-(ethoxymethyl)-10-formyl-1,7-dimethyl-6-oxo-3,9-dipentoxybenzo[b][1,4]benzodioxepine-2-carboxylic acid (PubChem CID 142792751) has the molecular formula C30H38O9 and a molecular weight of 542.63 g/mol. Its IUPAC name is 4-(ethoxymethyl)-10-formyl-1,7-dimethyl-6-oxo-3,9-dipentoxybenzo[b][1,4]benzodioxepine-2-carboxylic acid.
| Compound Name | 4-(ethoxymethyl)-10-formyl-1,7-dimethyl-6-oxo-3,9-dipentoxybenzo[b][1,4]benzodioxepine-2-carboxylic acid |
|---|---|
| PubChem CID | 142792751 |
| Molecular Formula | C30H38O9 |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | 4-(ethoxymethyl)-10-formyl-1,7-dimethyl-6-oxo-3,9-dipentoxybenzo[b][1,4]benzodioxepine-2-carboxylic acid |
| SMILES | CCCCCOc1cc(C)c2c(c1C=O)Oc1c(C)c(C(=O)O)c(OCCCCC)c(COCC)c1OC2=O |
| InChI | InChI=1S/C30H38O9/c1-6-9-11-13-36-22-15-18(4)23-27(20(22)16-31)38-25-19(5)24(29(32)33)26(37-14-12-10-7-2)21(17-35-8-3)28(25)39-30(23)34/h15-16H,6-14,17H2,1-5H3,(H,32,33) |
| InChIKey | KFRFSUXXSJEVLQ-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|