C28H39ClO11 — CID 160796245
2,4-bis(ethoxymethoxy)-6-methylbenzaldehyde;3-chloro-4,6-bis(ethoxymethoxy)-2-methylbenzoic acid (PubChem CID 160796245) has the molecular formula C28H39ClO11 and a molecular weight of 587.06 g/mol. Its IUPAC name is 2,4-bis(ethoxymethoxy)-6-methylbenzaldehyde;3-chloro-4,6-bis(ethoxymethoxy)-2-methylbenzoic acid.
| Compound Name | 2,4-bis(ethoxymethoxy)-6-methylbenzaldehyde;3-chloro-4,6-bis(ethoxymethoxy)-2-methylbenzoic acid |
|---|---|
| PubChem CID | 160796245 |
| Molecular Formula | C28H39ClO11 |
| Molecular Weight | 587.06 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | 2,4-bis(ethoxymethoxy)-6-methylbenzaldehyde;3-chloro-4,6-bis(ethoxymethoxy)-2-methylbenzoic acid |
| SMILES | CCOCOc1cc(C)c(C=O)c(OCOCC)c1.CCOCOc1cc(OCOCC)c(C(=O)O)c(C)c1Cl |
| InChI | InChI=1S/C14H19ClO6.C14H20O5/c1-4-18-7-20-10-6-11(21-8-19-5-2)13(15)9(3)12(10)14(16)17;1-4-16-9-18-12-6-11(3)13(8-15)14(7-12)19-10-17-5-2/h6H,4-5,7-8H2,1-3H3,(H,16,17);6-8H,4-5,9-10H2,1-3H3 |
| InChIKey | SCMCSEYGAGWTPO-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 128.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.06 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|