C18H25O6- — CID 58835602
2,5-dibutoxy-4-carboxy-3,6-dimethylbenzoate (PubChem CID 58835602) has the molecular formula C18H25O6- and a molecular weight of 337.39 g/mol. Its IUPAC name is 2,5-dibutoxy-4-carboxy-3,6-dimethylbenzoate.
| Compound Name | 2,5-dibutoxy-4-carboxy-3,6-dimethylbenzoate |
|---|---|
| PubChem CID | 58835602 |
| Molecular Formula | C18H25O6- |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 2,5-dibutoxy-4-carboxy-3,6-dimethylbenzoate |
| SMILES | CCCCOc1c(C)c(C(=O)O)c(OCCCC)c(C)c1C(=O)[O-] |
| InChI | InChI=1S/C18H26O6/c1-5-7-9-23-15-11(3)14(18(21)22)16(24-10-8-6-2)12(4)13(15)17(19)20/h5-10H2,1-4H3,(H,19,20)(H,21,22)/p-1 |
| InChIKey | YPAALKYNDZZGPL-UHFFFAOYSA-M |
| XLogP | 2.72 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|