C13H12O6 — CID 23241620
ethyl 6-methoxy-4-methyl-1,3-dioxo-2-benzofuran-5-carboxylate (PubChem CID 23241620) has the molecular formula C13H12O6 and a molecular weight of 264.23 g/mol. Its IUPAC name is ethyl 6-methoxy-4-methyl-1,3-dioxo-2-benzofuran-5-carboxylate.
| Compound Name | ethyl 6-methoxy-4-methyl-1,3-dioxo-2-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 23241620 |
| Molecular Formula | C13H12O6 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | ethyl 6-methoxy-4-methyl-1,3-dioxo-2-benzofuran-5-carboxylate |
| SMILES | CCOC(=O)c1c(OC)cc2c(c1C)C(=O)OC2=O |
| InChI | InChI=1S/C13H12O6/c1-4-18-12(15)10-6(2)9-7(5-8(10)17-3)11(14)19-13(9)16/h5H,4H2,1-3H3 |
| InChIKey | RWCXYDLCRBFFRF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|