C12H15IO4 — CID 10871806
ethyl 3-iodo-4,6-dimethoxy-2-methylbenzoate (PubChem CID 10871806) has the molecular formula C12H15IO4 and a molecular weight of 350.15 g/mol. Its IUPAC name is ethyl 3-iodo-4,6-dimethoxy-2-methylbenzoate.
| Compound Name | ethyl 3-iodo-4,6-dimethoxy-2-methylbenzoate |
|---|---|
| PubChem CID | 10871806 |
| Molecular Formula | C12H15IO4 |
| Molecular Weight | 350.15 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | ethyl 3-iodo-4,6-dimethoxy-2-methylbenzoate |
| SMILES | CCOC(=O)c1c(OC)cc(OC)c(I)c1C |
| InChI | InChI=1S/C12H15IO4/c1-5-17-12(14)10-7(2)11(13)9(16-4)6-8(10)15-3/h6H,5H2,1-4H3 |
| InChIKey | UXKJOVHKXAIOCV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.15 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|