C18H19IO6S — CID 86677123
ethyl 6-(benzenesulfonylmethyl)-3-iodo-2,4-dimethoxybenzoate (PubChem CID 86677123) has the molecular formula C18H19IO6S and a molecular weight of 490.32 g/mol. Its IUPAC name is ethyl 6-(benzenesulfonylmethyl)-3-iodo-2,4-dimethoxybenzoate.
| Compound Name | ethyl 6-(benzenesulfonylmethyl)-3-iodo-2,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 86677123 |
| Molecular Formula | C18H19IO6S |
| Molecular Weight | 490.32 g/mol |
| Exact Mass | 489.99 |
| IUPAC Name | ethyl 6-(benzenesulfonylmethyl)-3-iodo-2,4-dimethoxybenzoate |
| SMILES | CCOC(=O)c1c(CS(=O)(=O)c2ccccc2)cc(OC)c(I)c1OC |
| InChI | InChI=1S/C18H19IO6S/c1-4-25-18(20)15-12(10-14(23-2)16(19)17(15)24-3)11-26(21,22)13-8-6-5-7-9-13/h5-10H,4,11H2,1-3H3 |
| InChIKey | HRPASYIHCUXFJO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|