C16H16O5S — CID 102531525
2-(benzenesulfonylmethyl)-4,5-dimethoxybenzaldehyde (PubChem CID 102531525) has the molecular formula C16H16O5S and a molecular weight of 320.37 g/mol. Its IUPAC name is 2-(benzenesulfonylmethyl)-4,5-dimethoxybenzaldehyde.
| Compound Name | 2-(benzenesulfonylmethyl)-4,5-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 102531525 |
| Molecular Formula | C16H16O5S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 2-(benzenesulfonylmethyl)-4,5-dimethoxybenzaldehyde |
| SMILES | COc1cc(C=O)c(CS(=O)(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C16H16O5S/c1-20-15-8-12(10-17)13(9-16(15)21-2)11-22(18,19)14-6-4-3-5-7-14/h3-10H,11H2,1-2H3 |
| InChIKey | XXLDTTUKHVYMTC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|