C11H12O4 — CID 134869051
4,5-dimethoxy-2-(2-oxoethyl)benzaldehyde (PubChem CID 134869051) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is 4,5-dimethoxy-2-(2-oxoethyl)benzaldehyde.
| Compound Name | 4,5-dimethoxy-2-(2-oxoethyl)benzaldehyde |
|---|---|
| PubChem CID | 134869051 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 4,5-dimethoxy-2-(2-oxoethyl)benzaldehyde |
| SMILES | COc1cc(C=O)c(CC=O)cc1OC |
| InChI | InChI=1S/C11H12O4/c1-14-10-5-8(3-4-12)9(7-13)6-11(10)15-2/h4-7H,3H2,1-2H3 |
| InChIKey | ZQSVYXOPFLDIKY-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|