C11H11NO4 — CID 117315279
2-(isocyanatomethyl)-4,5-dimethoxybenzaldehyde (PubChem CID 117315279) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is 2-(isocyanatomethyl)-4,5-dimethoxybenzaldehyde.
| Compound Name | 2-(isocyanatomethyl)-4,5-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 117315279 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 2-(isocyanatomethyl)-4,5-dimethoxybenzaldehyde |
| SMILES | COc1cc(C=O)c(CN=C=O)cc1OC |
| InChI | InChI=1S/C11H11NO4/c1-15-10-3-8(5-12-7-14)9(6-13)4-11(10)16-2/h3-4,6H,5H2,1-2H3 |
| InChIKey | PLOKLLIVTRABPJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|