C27H30O11 — CID 22853408
ethyl 3,5,6-trimethoxy-1-methyl-9,10-dioxo-7-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]anthracene-2-carboxylate (PubChem CID 22853408) has the molecular formula C27H30O11 and a molecular weight of 530.53 g/mol. Its IUPAC name is ethyl 3,5,6-trimethoxy-1-methyl-9,10-dioxo-7-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]anthracene-2-carboxylate.
| Compound Name | ethyl 3,5,6-trimethoxy-1-methyl-9,10-dioxo-7-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]anthracene-2-carboxylate |
|---|---|
| PubChem CID | 22853408 |
| Molecular Formula | C27H30O11 |
| Molecular Weight | 530.53 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | ethyl 3,5,6-trimethoxy-1-methyl-9,10-dioxo-7-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]anthracene-2-carboxylate |
| SMILES | CCOC(=O)c1c(OC)cc2c(c1C)C(=O)c1cc([C@H]3O[C@@H](C)[C@@H](O)[C@@H](O)[C@H]3O)c(OC)c(OC)c1C2=O |
| InChI | InChI=1S/C27H30O11/c1-7-37-27(33)17-10(2)16-13(9-15(17)34-4)21(30)18-12(20(16)29)8-14(25(35-5)26(18)36-6)24-23(32)22(31)19(28)11(3)38-24/h8-9,11,19,22-24,28,31-32H,7H2,1-6H3/t11-,19+,22+,23+,24+/m0/s1 |
| InChIKey | BJZIMUKYZMJYNY-LVXCHSILSA-N |
| XLogP | 1.52 |
| TPSA | 158.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.53 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|