C26H38O14 — CID 18664203
methyl 3,4,5-tris[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]benzoate (PubChem CID 18664203) has the molecular formula C26H38O14 and a molecular weight of 574.58 g/mol. Its IUPAC name is methyl 3,4,5-tris[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]benzoate.
| Compound Name | methyl 3,4,5-tris[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]benzoate |
|---|---|
| PubChem CID | 18664203 |
| Molecular Formula | C26H38O14 |
| Molecular Weight | 574.58 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | methyl 3,4,5-tris[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]benzoate |
| SMILES | COC(=O)c1cc(C2O[C@H](C)[C@H](O)[C@H](O)[C@H]2O)c(C2O[C@H](C)[C@H](O)[C@H](O)[C@H]2O)c(C2O[C@H](C)[C@H](O)[C@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C26H38O14/c1-7-14(27)17(30)20(33)23(38-7)11-5-10(26(36)37-4)6-12(24-21(34)18(31)15(28)8(2)39-24)13(11)25-22(35)19(32)16(29)9(3)40-25/h5-9,14-25,27-35H,1-4H3/t7-,8-,9-,14+,15+,16+,17+,18+,19+,20-,21-,22-,23?,24?,25?/m1/s1 |
| InChIKey | HOVRRDPDZLZKRU-LJEGENKDSA-N |
| XLogP | -2.90 |
| TPSA | 236.06 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.58 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |