C15H16O6 — CID 11119876
3-ethyl-5-hydroxy-2,6,7-trimethoxynaphthalene-1,4-dione (PubChem CID 11119876) has the molecular formula C15H16O6 and a molecular weight of 292.29 g/mol. Its IUPAC name is 3-ethyl-5-hydroxy-2,6,7-trimethoxynaphthalene-1,4-dione.
| Compound Name | 3-ethyl-5-hydroxy-2,6,7-trimethoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 11119876 |
| Molecular Formula | C15H16O6 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 3-ethyl-5-hydroxy-2,6,7-trimethoxynaphthalene-1,4-dione |
| SMILES | CCC1=C(OC)C(=O)c2cc(OC)c(OC)c(O)c2C1=O |
| InChI | InChI=1S/C15H16O6/c1-5-7-11(16)10-8(12(17)14(7)20-3)6-9(19-2)15(21-4)13(10)18/h6,18H,5H2,1-4H3 |
| InChIKey | UAGRZTOQRLUIEG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|