C17H18O7 — CID 15082047
6-(hydroxymethyl)-2,5,8-trimethoxy-3-(2-oxopropyl)naphthalene-1,4-dione (PubChem CID 15082047) has the molecular formula C17H18O7 and a molecular weight of 334.32 g/mol. Its IUPAC name is 6-(hydroxymethyl)-2,5,8-trimethoxy-3-(2-oxopropyl)naphthalene-1,4-dione.
| Compound Name | 6-(hydroxymethyl)-2,5,8-trimethoxy-3-(2-oxopropyl)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 15082047 |
| Molecular Formula | C17H18O7 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 6-(hydroxymethyl)-2,5,8-trimethoxy-3-(2-oxopropyl)naphthalene-1,4-dione |
| SMILES | COC1=C(CC(C)=O)C(=O)c2c(OC)c(CO)cc(OC)c2C1=O |
| InChI | InChI=1S/C17H18O7/c1-8(19)5-10-14(20)13-12(15(21)17(10)24-4)11(22-2)6-9(7-18)16(13)23-3/h6,18H,5,7H2,1-4H3 |
| InChIKey | WCOYFXULLSRJJT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|