C16H13O8- — CID 102514981
6-carboxy-2,4-dimethoxy-5,8-dioxo-7-(2-oxopropyl)naphthalen-1-olate (PubChem CID 102514981) has the molecular formula C16H13O8- and a molecular weight of 333.27 g/mol. Its IUPAC name is 6-carboxy-2,4-dimethoxy-5,8-dioxo-7-(2-oxopropyl)naphthalen-1-olate.
| Compound Name | 6-carboxy-2,4-dimethoxy-5,8-dioxo-7-(2-oxopropyl)naphthalen-1-olate |
|---|---|
| PubChem CID | 102514981 |
| Molecular Formula | C16H13O8- |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 6-carboxy-2,4-dimethoxy-5,8-dioxo-7-(2-oxopropyl)naphthalen-1-olate |
| SMILES | COc1cc(OC)c2c(c1[O-])C(=O)C(CC(C)=O)=C(C(=O)O)C2=O |
| InChI | InChI=1S/C16H14O8/c1-6(17)4-7-10(16(21)22)15(20)11-8(23-2)5-9(24-3)14(19)12(11)13(7)18/h5,19H,4H2,1-3H3,(H,21,22)/p-1 |
| InChIKey | HAWLFWNWPUHWPQ-UHFFFAOYSA-M |
| XLogP | 0.52 |
| TPSA | 130.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|