C13H13NO5 — CID 12581011
4,6-dimethoxy-1-(2-oxopropyl)indole-2,3-dione (PubChem CID 12581011) has the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. Its IUPAC name is 4,6-dimethoxy-1-(2-oxopropyl)indole-2,3-dione.
| Compound Name | 4,6-dimethoxy-1-(2-oxopropyl)indole-2,3-dione |
|---|---|
| PubChem CID | 12581011 |
| Molecular Formula | C13H13NO5 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 4,6-dimethoxy-1-(2-oxopropyl)indole-2,3-dione |
| SMILES | COc1cc(OC)c2c(c1)N(CC(C)=O)C(=O)C2=O |
| InChI | InChI=1S/C13H13NO5/c1-7(15)6-14-9-4-8(18-2)5-10(19-3)11(9)12(16)13(14)17/h4-5H,6H2,1-3H3 |
| InChIKey | PJCXQTDTECYRAP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|