C11H8ClNO5 — CID 84641418
2-(6-chloro-5-methoxy-2,3-dioxoindol-1-yl)acetic acid (PubChem CID 84641418) has the molecular formula C11H8ClNO5 and a molecular weight of 269.64 g/mol. Its IUPAC name is 2-(6-chloro-5-methoxy-2,3-dioxoindol-1-yl)acetic acid.
| Compound Name | 2-(6-chloro-5-methoxy-2,3-dioxoindol-1-yl)acetic acid |
|---|---|
| PubChem CID | 84641418 |
| Molecular Formula | C11H8ClNO5 |
| Molecular Weight | 269.64 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 2-(6-chloro-5-methoxy-2,3-dioxoindol-1-yl)acetic acid |
| SMILES | COc1cc2c(cc1Cl)N(CC(=O)O)C(=O)C2=O |
| InChI | InChI=1S/C11H8ClNO5/c1-18-8-2-5-7(3-6(8)12)13(4-9(14)15)11(17)10(5)16/h2-3H,4H2,1H3,(H,14,15) |
| InChIKey | WOLGNGKVGYQLPX-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.64 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|