2-(6-chloro-5-methoxy-2,3-dioxoindol-1-yl)acetic acid

C11H8ClNO5 — CID 84641418

IUPAC2-(6-chloro-5-methoxy-2,3-dioxoindol-1-yl)acetic acid
SMILESCOc1cc2c(cc1Cl)N(CC(=O)O)C(=O)C2=O
InChIInChI=1S/C11H8ClNO5/c1-18-8-2-5-7(3-6(8)12)13(4-9(14)15)11(17)10(5)16/h2-3H,4H2,1H3,(H,14,15)
InChIKeyWOLGNGKVGYQLPX-UHFFFAOYSA-N
MW269.64 g/mol
LogP0.96
Rot. Bonds3

About 2-(6-chloro-5-methoxy-2,3-dioxoindol-1-yl)acetic acid

2-(6-chloro-5-methoxy-2,3-dioxoindol-1-yl)acetic acid (PubChem CID 84641418) has the molecular formula C11H8ClNO5 and a molecular weight of 269.64 g/mol. Its IUPAC name is 2-(6-chloro-5-methoxy-2,3-dioxoindol-1-yl)acetic acid.

Molecular Properties

Compound Name2-(6-chloro-5-methoxy-2,3-dioxoindol-1-yl)acetic acid
PubChem CID84641418
Molecular FormulaC11H8ClNO5
Molecular Weight269.64 g/mol
Exact Mass269.01
IUPAC Name2-(6-chloro-5-methoxy-2,3-dioxoindol-1-yl)acetic acid
SMILESCOc1cc2c(cc1Cl)N(CC(=O)O)C(=O)C2=O
InChIInChI=1S/C11H8ClNO5/c1-18-8-2-5-7(3-6(8)12)13(4-9(14)15)11(17)10(5)16/h2-3H,4H2,1H3,(H,14,15)
InChIKeyWOLGNGKVGYQLPX-UHFFFAOYSA-N
XLogP0.96
TPSA83.91 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.64
LogP ≤ 50.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 2-(6-chloro-5-methoxy-2,3-dioxoindol-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-chloro-5-methoxy-2,3-dioxoindol-1-yl)acetic acid?
The IUPAC name of 2-(6-chloro-5-methoxy-2,3-dioxoindol-1-yl)acetic acid (CID 84641418) is 2-(6-chloro-5-methoxy-2,3-dioxoindol-1-yl)acetic acid.
What is the SMILES notation for 2-(6-chloro-5-methoxy-2,3-dioxoindol-1-yl)acetic acid?
The canonical SMILES for 2-(6-chloro-5-methoxy-2,3-dioxoindol-1-yl)acetic acid is COc1cc2c(cc1Cl)N(CC(=O)O)C(=O)C2=O.
What is the InChIKey of 2-(6-chloro-5-methoxy-2,3-dioxoindol-1-yl)acetic acid?
The InChIKey is WOLGNGKVGYQLPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClNO5/c1-18-8-2-5-7(3-6(8)12)13(4-9(14)15)11(17)10(5)16/h2-3H,4H2,1H3,(H,14,15).
What are the key properties of 2-(6-chloro-5-methoxy-2,3-dioxoindol-1-yl)acetic acid?
2-(6-chloro-5-methoxy-2,3-dioxoindol-1-yl)acetic acid has a molecular weight of 269.64 g/mol, XLogP of 0.96, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chloro-5-methoxy-2,3-dioxoindol-1-yl)acetic acid is sourced from PubChem (CID 84641418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).