C30H26O12 — CID 14973093
methyl 2-[8-[2,4-dimethoxy-7-(2-methoxy-2-oxoethyl)-5,6-dioxonaphthalen-1-yl]-5,7-dimethoxy-3,4-dioxonaphthalen-2-yl]acetate (PubChem CID 14973093) has the molecular formula C30H26O12 and a molecular weight of 578.53 g/mol. Its IUPAC name is methyl 2-[8-[2,4-dimethoxy-7-(2-methoxy-2-oxoethyl)-5,6-dioxonaphthalen-1-yl]-5,7-dimethoxy-3,4-dioxonaphthalen-2-yl]acetate.
| Compound Name | methyl 2-[8-[2,4-dimethoxy-7-(2-methoxy-2-oxoethyl)-5,6-dioxonaphthalen-1-yl]-5,7-dimethoxy-3,4-dioxonaphthalen-2-yl]acetate |
|---|---|
| PubChem CID | 14973093 |
| Molecular Formula | C30H26O12 |
| Molecular Weight | 578.53 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | methyl 2-[8-[2,4-dimethoxy-7-(2-methoxy-2-oxoethyl)-5,6-dioxonaphthalen-1-yl]-5,7-dimethoxy-3,4-dioxonaphthalen-2-yl]acetate |
| SMILES | COC(=O)CC1=Cc2c(c(OC)cc(OC)c2-c2c(OC)cc(OC)c3c2C=C(CC(=O)OC)C(=O)C3=O)C(=O)C1=O |
| InChI | InChI=1S/C30H26O12/c1-37-17-11-19(39-3)25-15(7-13(9-21(31)41-5)27(33)29(25)35)23(17)24-16-8-14(10-22(32)42-6)28(34)30(36)26(16)20(40-4)12-18(24)38-2/h7-8,11-12H,9-10H2,1-6H3 |
| InChIKey | CRCWAWBEXVLMCH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|