C13H15NO4 — CID 169466691
N-[3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-enyl]acetamide (PubChem CID 169466691) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is N-[3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-enyl]acetamide.
| Compound Name | N-[3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 169466691 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | N-[3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-enyl]acetamide |
| SMILES | COc1cc(C=CCNC(C)=O)cc2c1OCO2 |
| InChI | InChI=1S/C13H15NO4/c1-9(15)14-5-3-4-10-6-11(16-2)13-12(7-10)17-8-18-13/h3-4,6-7H,5,8H2,1-2H3,(H,14,15) |
| InChIKey | YFJYVUTTZIMBLC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |