C17H20O6 — CID 11638335
2-ethyl-3,5,6,8-tetramethoxy-7-methylnaphthalene-1,4-dione (PubChem CID 11638335) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is 2-ethyl-3,5,6,8-tetramethoxy-7-methylnaphthalene-1,4-dione.
| Compound Name | 2-ethyl-3,5,6,8-tetramethoxy-7-methylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 11638335 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-ethyl-3,5,6,8-tetramethoxy-7-methylnaphthalene-1,4-dione |
| SMILES | CCC1=C(OC)C(=O)c2c(OC)c(OC)c(C)c(OC)c2C1=O |
| InChI | InChI=1S/C17H20O6/c1-7-9-12(18)10-11(13(19)16(9)22-5)17(23-6)15(21-4)8(2)14(10)20-3/h7H2,1-6H3 |
| InChIKey | SOWUOSLQGPLXJJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|