C9H8Cl2O4 — CID 140966674
methyl 2,5-dichloro-3,6-dihydroxy-4-methylbenzoate (PubChem CID 140966674) has the molecular formula C9H8Cl2O4 and a molecular weight of 251.06 g/mol. Its IUPAC name is methyl 2,5-dichloro-3,6-dihydroxy-4-methylbenzoate.
| Compound Name | methyl 2,5-dichloro-3,6-dihydroxy-4-methylbenzoate |
|---|---|
| PubChem CID | 140966674 |
| Molecular Formula | C9H8Cl2O4 |
| Molecular Weight | 251.06 g/mol |
| Exact Mass | 249.98 |
| IUPAC Name | methyl 2,5-dichloro-3,6-dihydroxy-4-methylbenzoate |
| SMILES | COC(=O)c1c(O)c(Cl)c(C)c(O)c1Cl |
| InChI | InChI=1S/C9H8Cl2O4/c1-3-5(10)8(13)4(9(14)15-2)6(11)7(3)12/h12-13H,1-2H3 |
| InChIKey | ACSOPQDJLDSEQM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.06 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|