C34H26Cl2O13 — CID 137002655
4,6a,9,10-tetrahydroxy-6,7-dihydroindeno[2,1-c]chromen-3-one;methyl 8,10-dichloro-3,9-dihydroxy-1,4,7-trimethyl-6-oxobenzo[b][1,4]benzodioxepine-2-carboxylate (PubChem CID 137002655) has the molecular formula C34H26Cl2O13 and a molecular weight of 713.47 g/mol. Its IUPAC name is 4,6a,9,10-tetrahydroxy-6,7-dihydroindeno[2,1-c]chromen-3-one;methyl 8,10-dichloro-3,9-dihydroxy-1,4,7-trimethyl-6-oxobenzo[b][1,4]benzodioxepine-2-carboxylate.
| Compound Name | 4,6a,9,10-tetrahydroxy-6,7-dihydroindeno[2,1-c]chromen-3-one;methyl 8,10-dichloro-3,9-dihydroxy-1,4,7-trimethyl-6-oxobenzo[b][1,4]benzodioxepine-2-carboxylate |
|---|---|
| PubChem CID | 137002655 |
| Molecular Formula | C34H26Cl2O13 |
| Molecular Weight | 713.47 g/mol |
| Exact Mass | 712.08 |
| IUPAC Name | 4,6a,9,10-tetrahydroxy-6,7-dihydroindeno[2,1-c]chromen-3-one;methyl 8,10-dichloro-3,9-dihydroxy-1,4,7-trimethyl-6-oxobenzo[b][1,4]benzodioxepine-2-carboxylate |
| SMILES | COC(=O)c1c(C)c2c(c(C)c1O)OC(=O)c1c(C)c(Cl)c(O)c(Cl)c1O2.O=C1C=CC2=C3c4cc(O)c(O)cc4CC3(O)COC2=C1O |
| InChI | InChI=1S/C18H14Cl2O7.C16H12O6/c1-5-9-16(11(20)13(22)10(5)19)26-14-6(2)8(17(23)25-4)12(21)7(3)15(14)27-18(9)24;17-10-2-1-8-13-9-4-12(19)11(18)3-7(9)5-16(13,21)6-22-15(8)14(10)20/h21-22H,1-4H3;1-4,18-21H,5-6H2 |
| InChIKey | FVRRFPQJUJGZLT-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 209.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 49 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.47 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|