C10H8ClNO5 — CID 139653229
methyl 6-chloro-7-hydroxy-3-oxo-4H-1,4-benzoxazine-8-carboxylate (PubChem CID 139653229) has the molecular formula C10H8ClNO5 and a molecular weight of 257.63 g/mol. Its IUPAC name is methyl 6-chloro-7-hydroxy-3-oxo-4H-1,4-benzoxazine-8-carboxylate.
| Compound Name | methyl 6-chloro-7-hydroxy-3-oxo-4H-1,4-benzoxazine-8-carboxylate |
|---|---|
| PubChem CID | 139653229 |
| Molecular Formula | C10H8ClNO5 |
| Molecular Weight | 257.63 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | methyl 6-chloro-7-hydroxy-3-oxo-4H-1,4-benzoxazine-8-carboxylate |
| SMILES | COC(=O)c1c(O)c(Cl)cc2c1OCC(=O)N2 |
| InChI | InChI=1S/C10H8ClNO5/c1-16-10(15)7-8(14)4(11)2-5-9(7)17-3-6(13)12-5/h2,14H,3H2,1H3,(H,12,13) |
| InChIKey | BYSJCXSLLJHCKU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.63 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|