C28H24O15 — CID 51398152
[(17R)-5,13-diacetyloxy-4-(diacetyloxymethyl)-7,12-dimethyl-9,15-dioxo-2,10,16-trioxatetracyclo[9.7.0.03,8.014,18]octadeca-1(18),3(8),4,6,11,13-hexaen-17-yl] acetate (PubChem CID 51398152) has the molecular formula C28H24O15 and a molecular weight of 600.49 g/mol. Its IUPAC name is [(17R)-5,13-diacetyloxy-4-(diacetyloxymethyl)-7,12-dimethyl-9,15-dioxo-2,10,16-trioxatetracyclo[9.7.0.03,8.014,18]octadeca-1(18),3(8),4,6,11,13-hexaen-17-yl] acetate.
| Compound Name | [(17R)-5,13-diacetyloxy-4-(diacetyloxymethyl)-7,12-dimethyl-9,15-dioxo-2,10,16-trioxatetracyclo[9.7.0.03,8.014,18]octadeca-1(18),3(8),4,6,11,13-hexaen-17-yl] acetate |
|---|---|
| PubChem CID | 51398152 |
| Molecular Formula | C28H24O15 |
| Molecular Weight | 600.49 g/mol |
| Exact Mass | 600.11 |
| IUPAC Name | [(17R)-5,13-diacetyloxy-4-(diacetyloxymethyl)-7,12-dimethyl-9,15-dioxo-2,10,16-trioxatetracyclo[9.7.0.03,8.014,18]octadeca-1(18),3(8),4,6,11,13-hexaen-17-yl] acetate |
| SMILES | CC(=O)Oc1cc(C)c2c(c1C(OC(C)=O)OC(C)=O)Oc1c(c(C)c(OC(C)=O)c3c1[C@H](OC(C)=O)OC3=O)OC2=O |
| InChI | InChI=1S/C28H24O15/c1-9-8-16(36-11(3)29)18(27(38-13(5)31)39-14(6)32)23-17(9)25(34)42-22-10(2)21(37-12(4)30)19-20(24(22)41-23)28(40-15(7)33)43-26(19)35/h8,27-28H,1-7H3/t28-/m1/s1 |
| InChIKey | WRJZHQYUZXGMTL-MUUNZHRXSA-N |
| XLogP | 3.34 |
| TPSA | 193.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|