C21H20O2S2 — CID 69097295
[3-methyl-6,7-bis(methylsulfanyl)-4-phenylnaphthalen-1-yl] acetate (PubChem CID 69097295) has the molecular formula C21H20O2S2 and a molecular weight of 368.52 g/mol. Its IUPAC name is [3-methyl-6,7-bis(methylsulfanyl)-4-phenylnaphthalen-1-yl] acetate.
| Compound Name | [3-methyl-6,7-bis(methylsulfanyl)-4-phenylnaphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 69097295 |
| Molecular Formula | C21H20O2S2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | [3-methyl-6,7-bis(methylsulfanyl)-4-phenylnaphthalen-1-yl] acetate |
| SMILES | CSc1cc2c(OC(C)=O)cc(C)c(-c3ccccc3)c2cc1SC |
| InChI | InChI=1S/C21H20O2S2/c1-13-10-18(23-14(2)22)16-11-19(24-3)20(25-4)12-17(16)21(13)15-8-6-5-7-9-15/h5-12H,1-4H3 |
| InChIKey | ZXDOUDMTGCJITC-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|