C28H26O3S — CID 90337882
[6-(2,6-dimethylphenyl)sulfanyl-7-methoxy-3-methyl-4-phenylnaphthalen-1-yl] acetate (PubChem CID 90337882) has the molecular formula C28H26O3S and a molecular weight of 442.58 g/mol. Its IUPAC name is [6-(2,6-dimethylphenyl)sulfanyl-7-methoxy-3-methyl-4-phenylnaphthalen-1-yl] acetate.
| Compound Name | [6-(2,6-dimethylphenyl)sulfanyl-7-methoxy-3-methyl-4-phenylnaphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 90337882 |
| Molecular Formula | C28H26O3S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | [6-(2,6-dimethylphenyl)sulfanyl-7-methoxy-3-methyl-4-phenylnaphthalen-1-yl] acetate |
| SMILES | COc1cc2c(OC(C)=O)cc(C)c(-c3ccccc3)c2cc1Sc1c(C)cccc1C |
| InChI | InChI=1S/C28H26O3S/c1-17-10-9-11-18(2)28(17)32-26-16-23-22(15-25(26)30-5)24(31-20(4)29)14-19(3)27(23)21-12-7-6-8-13-21/h6-16H,1-5H3 |
| InChIKey | WRSDZIPBDJJEKA-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|