C24H24O8 — CID 18369996
methyl 4-acetyloxy-1-(3,4-dimethoxyphenyl)-6,7-dimethoxynaphthalene-2-carboxylate (PubChem CID 18369996) has the molecular formula C24H24O8 and a molecular weight of 440.45 g/mol. Its IUPAC name is methyl 4-acetyloxy-1-(3,4-dimethoxyphenyl)-6,7-dimethoxynaphthalene-2-carboxylate.
| Compound Name | methyl 4-acetyloxy-1-(3,4-dimethoxyphenyl)-6,7-dimethoxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 18369996 |
| Molecular Formula | C24H24O8 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | methyl 4-acetyloxy-1-(3,4-dimethoxyphenyl)-6,7-dimethoxynaphthalene-2-carboxylate |
| SMILES | COC(=O)c1cc(OC(C)=O)c2cc(OC)c(OC)cc2c1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C24H24O8/c1-13(25)32-19-12-17(24(26)31-6)23(14-7-8-18(27-2)20(9-14)28-3)16-11-22(30-5)21(29-4)10-15(16)19/h7-12H,1-6H3 |
| InChIKey | AURGJEKCAKVHMK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|