methyl 1-(3,4-dimethoxyphenyl)-9H-carbazole-2-carboxylate

C22H19NO4 — CID 150364727

IUPACmethyl 1-(3,4-dimethoxyphenyl)-9H-carbazole-2-carboxylate
SMILESCOC(=O)c1ccc2c([nH]c3ccccc32)c1-c1ccc(OC)c(OC)c1
InChIInChI=1S/C22H19NO4/c1-25-18-11-8-13(12-19(18)26-2)20-16(22(24)27-3)10-9-15-14-6-4-5-7-17(14)23-21(15)20/h4-12,23H,1-3H3
InChIKeyGWLOECOEFBMBAV-UHFFFAOYSA-N
MW361.40 g/mol
LogP4.79
Rot. Bonds4

About methyl 1-(3,4-dimethoxyphenyl)-9H-carbazole-2-carboxylate

methyl 1-(3,4-dimethoxyphenyl)-9H-carbazole-2-carboxylate (PubChem CID 150364727) has the molecular formula C22H19NO4 and a molecular weight of 361.40 g/mol. Its IUPAC name is methyl 1-(3,4-dimethoxyphenyl)-9H-carbazole-2-carboxylate.

Molecular Properties

Compound Namemethyl 1-(3,4-dimethoxyphenyl)-9H-carbazole-2-carboxylate
PubChem CID150364727
Molecular FormulaC22H19NO4
Molecular Weight361.40 g/mol
Exact Mass361.13
IUPAC Namemethyl 1-(3,4-dimethoxyphenyl)-9H-carbazole-2-carboxylate
SMILESCOC(=O)c1ccc2c([nH]c3ccccc32)c1-c1ccc(OC)c(OC)c1
InChIInChI=1S/C22H19NO4/c1-25-18-11-8-13(12-19(18)26-2)20-16(22(24)27-3)10-9-15-14-6-4-5-7-17(14)23-21(15)20/h4-12,23H,1-3H3
InChIKeyGWLOECOEFBMBAV-UHFFFAOYSA-N
XLogP4.79
TPSA60.55 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500361.40
LogP ≤ 54.79
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 1-(3,4-dimethoxyphenyl)-9H-carbazole-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-(3,4-dimethoxyphenyl)-9H-carbazole-2-carboxylate?
The IUPAC name of methyl 1-(3,4-dimethoxyphenyl)-9H-carbazole-2-carboxylate (CID 150364727) is methyl 1-(3,4-dimethoxyphenyl)-9H-carbazole-2-carboxylate.
What is the SMILES notation for methyl 1-(3,4-dimethoxyphenyl)-9H-carbazole-2-carboxylate?
The canonical SMILES for methyl 1-(3,4-dimethoxyphenyl)-9H-carbazole-2-carboxylate is COC(=O)c1ccc2c([nH]c3ccccc32)c1-c1ccc(OC)c(OC)c1.
What is the InChIKey of methyl 1-(3,4-dimethoxyphenyl)-9H-carbazole-2-carboxylate?
The InChIKey is GWLOECOEFBMBAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19NO4/c1-25-18-11-8-13(12-19(18)26-2)20-16(22(24)27-3)10-9-15-14-6-4-5-7-17(14)23-21(15)20/h4-12,23H,1-3H3.
What are the key properties of methyl 1-(3,4-dimethoxyphenyl)-9H-carbazole-2-carboxylate?
methyl 1-(3,4-dimethoxyphenyl)-9H-carbazole-2-carboxylate has a molecular weight of 361.40 g/mol, XLogP of 4.79, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(3,4-dimethoxyphenyl)-9H-carbazole-2-carboxylate is sourced from PubChem (CID 150364727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).